C19H17N5O4S — CID 97301449
3-amino-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thieno[2,3-b]pyridine-2-carbohydrazide (PubChem CID 97301449) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-amino-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thieno[2,3-b]pyridine-2-carbohydrazide.
| Compound Name | 3-amino-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thieno[2,3-b]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 97301449 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-amino-N'-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thieno[2,3-b]pyridine-2-carbohydrazide |
| SMILES | COc1ccc(N2C(=O)C[C@H](NNC(=O)c3sc4ncccc4c3N)C2=O)cc1 |
| InChI | InChI=1S/C19H17N5O4S/c1-28-11-6-4-10(5-7-11)24-14(25)9-13(19(24)27)22-23-17(26)16-15(20)12-3-2-8-21-18(12)29-16/h2-8,13,22H,9,20H2,1H3,(H,23,26)/t13-/m0/s1 |
| InChIKey | NPWYCPINVWHMLU-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|