C16H14F3N5O4 — CID 40619107
N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide (PubChem CID 40619107) has the molecular formula C16H14F3N5O4 and a molecular weight of 397.31 g/mol. Its IUPAC name is N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 40619107 |
| Molecular Formula | C16H14F3N5O4 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-5-(trifluoromethyl)-1H-pyrazole-3-carbohydrazide |
| SMILES | COc1ccc(N2C(=O)C[C@@H](NNC(=O)c3cc(C(F)(F)F)[nH]n3)C2=O)cc1 |
| InChI | InChI=1S/C16H14F3N5O4/c1-28-9-4-2-8(3-5-9)24-13(25)7-11(15(24)27)21-23-14(26)10-6-12(22-20-10)16(17,18)19/h2-6,11,21H,7H2,1H3,(H,20,22)(H,23,26)/t11-/m1/s1 |
| InChIKey | FQRWJOFTIRDBDF-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|