C16H21N3O5 — CID 92542330
tert-butyl N-[[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate (PubChem CID 92542330) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 92542330 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate |
| SMILES | COc1ccc(N2C(=O)C[C@@H](NNC(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C16H21N3O5/c1-16(2,3)24-15(22)18-17-12-9-13(20)19(14(12)21)10-5-7-11(23-4)8-6-10/h5-8,12,17H,9H2,1-4H3,(H,18,22)/t12-/m1/s1 |
| InChIKey | IMLJRRUGGRNMSL-GFCCVEGCSA-N |
| XLogP | 1.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|