C20H23N5O5S — CID 3375893
N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 3375893) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3375893 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | COc1cccc(N2C(=O)CC(NNC(=O)c3sc(N4CCOCC4)nc3C)C2=O)c1 |
| InChI | InChI=1S/C20H23N5O5S/c1-12-17(31-20(21-12)24-6-8-30-9-7-24)18(27)23-22-15-11-16(26)25(19(15)28)13-4-3-5-14(10-13)29-2/h3-5,10,15,22H,6-9,11H2,1-2H3,(H,23,27) |
| InChIKey | RFHQTDARWOHVMU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|