C24H21N3O8 — CID 5241889
3-[3-[2-[5-[(4-methoxyphenoxy)methyl]furan-2-carbonyl]hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 5241889) has the molecular formula C24H21N3O8 and a molecular weight of 479.45 g/mol. Its IUPAC name is 3-[3-[2-[5-[(4-methoxyphenoxy)methyl]furan-2-carbonyl]hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[3-[2-[5-[(4-methoxyphenoxy)methyl]furan-2-carbonyl]hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5241889 |
| Molecular Formula | C24H21N3O8 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 3-[3-[2-[5-[(4-methoxyphenoxy)methyl]furan-2-carbonyl]hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | COc1ccc(OCc2ccc(C(=O)NNC3CC(=O)N(c4cccc(C(=O)O)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H21N3O8/c1-33-16-5-7-17(8-6-16)34-13-18-9-10-20(35-18)22(29)26-25-19-12-21(28)27(23(19)30)15-4-2-3-14(11-15)24(31)32/h2-11,19,25H,12-13H2,1H3,(H,26,29)(H,31,32) |
| InChIKey | NULIWCJQBZSOFK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|