C23H21N3O5 — CID 9187490
N'-[3-(2-oxopyrrolidin-1-yl)benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 9187490) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N'-[3-(2-oxopyrrolidin-1-yl)benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[3-(2-oxopyrrolidin-1-yl)benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9187490 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N'-[3-(2-oxopyrrolidin-1-yl)benzoyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(COc2ccccc2)o1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C23H21N3O5/c27-21-10-5-13-26(21)17-7-4-6-16(14-17)22(28)24-25-23(29)20-12-11-19(31-20)15-30-18-8-2-1-3-9-18/h1-4,6-9,11-12,14H,5,10,13,15H2,(H,24,28)(H,25,29) |
| InChIKey | CXJCJZFCGIYJQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|