C22H19N3O5S — CID 22831162
4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide (PubChem CID 22831162) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide.
| Compound Name | 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
|---|---|
| PubChem CID | 22831162 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-oxo-N'-[5-(phenoxymethyl)furan-2-carbonyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
| SMILES | O=C1CCSc2ccc(C(=O)NNC(=O)c3ccc(COc4ccccc4)o3)cc2N1 |
| InChI | InChI=1S/C22H19N3O5S/c26-20-10-11-31-19-9-6-14(12-17(19)23-20)21(27)24-25-22(28)18-8-7-16(30-18)13-29-15-4-2-1-3-5-15/h1-9,12H,10-11,13H2,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | PZCOZGGJLUEPDX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|