C24H25N3O6S — CID 46521441
5-(phenoxymethyl)-N'-(3-piperidin-1-ylsulfonylbenzoyl)furan-2-carbohydrazide (PubChem CID 46521441) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is 5-(phenoxymethyl)-N'-(3-piperidin-1-ylsulfonylbenzoyl)furan-2-carbohydrazide.
| Compound Name | 5-(phenoxymethyl)-N'-(3-piperidin-1-ylsulfonylbenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 46521441 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-(phenoxymethyl)-N'-(3-piperidin-1-ylsulfonylbenzoyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(COc2ccccc2)o1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H25N3O6S/c28-23(18-8-7-11-21(16-18)34(30,31)27-14-5-2-6-15-27)25-26-24(29)22-13-12-20(33-22)17-32-19-9-3-1-4-10-19/h1,3-4,7-13,16H,2,5-6,14-15,17H2,(H,25,28)(H,26,29) |
| InChIKey | XVXXODDRXAYKMQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|