C19H16F3N3O4S — CID 18275527
4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide (PubChem CID 18275527) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is 4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide.
| Compound Name | 4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
|---|---|
| PubChem CID | 18275527 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 4-oxo-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NNC(=O)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C19H16F3N3O4S/c20-19(21,22)12-2-1-3-13(9-12)29-10-17(27)24-25-18(28)11-4-5-15-14(8-11)23-16(26)6-7-30-15/h1-5,8-9H,6-7,10H2,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | OGJMASDLBQEFHY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|