C19H16F3N3O4S — CID 55377611
2-(3-oxo-1,4-benzothiazin-4-yl)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]acetohydrazide (PubChem CID 55377611) has the molecular formula C19H16F3N3O4S and a molecular weight of 439.42 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]acetohydrazide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55377611 |
| Molecular Formula | C19H16F3N3O4S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]acetohydrazide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NNC(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C19H16F3N3O4S/c20-19(21,22)12-4-3-5-13(8-12)29-10-17(27)24-23-16(26)9-25-14-6-1-2-7-15(14)30-11-18(25)28/h1-8H,9-11H2,(H,23,26)(H,24,27) |
| InChIKey | WOQQXHUSCHJSNZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|