C18H18N2O3S — CID 18111140
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenoxyethyl)acetamide (PubChem CID 18111140) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 18111140 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)NCCOc1ccccc1 |
| InChI | InChI=1S/C18H18N2O3S/c21-17(19-10-11-23-14-6-2-1-3-7-14)12-20-15-8-4-5-9-16(15)24-13-18(20)22/h1-9H,10-13H2,(H,19,21) |
| InChIKey | XWCAVONDOZFCFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|