C17H23N3O2S — CID 5115832
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 5115832) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 5115832 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)NCCN1CCCCC1 |
| InChI | InChI=1S/C17H23N3O2S/c21-16(18-8-11-19-9-4-1-5-10-19)12-20-14-6-2-3-7-15(14)23-13-17(20)22/h2-3,6-7H,1,4-5,8-13H2,(H,18,21) |
| InChIKey | BLEIOVZSGSMNDN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |