C21H23N3O2S — CID 51195953
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide (PubChem CID 51195953) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51195953 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(2-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C21H23N3O2S/c25-20(14-24-18-10-4-5-11-19(18)27-15-21(24)26)22-16-8-2-3-9-17(16)23-12-6-1-7-13-23/h2-5,8-11H,1,6-7,12-15H2,(H,22,25) |
| InChIKey | GVRGGSOATFJHHI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |