C23H18ClN3O3S — CID 55466378
N-(4-chlorophenyl)-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]amino]benzamide (PubChem CID 55466378) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55466378 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[2-(3-oxo-1,4-benzothiazin-4-yl)acetyl]amino]benzamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)Nc1ccccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S/c24-15-9-11-16(12-10-15)25-23(30)17-5-1-2-6-18(17)26-21(28)13-27-19-7-3-4-8-20(19)31-14-22(27)29/h1-12H,13-14H2,(H,25,30)(H,26,28) |
| InChIKey | JYEATHUOJKWCSC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |