C16H12Br2N2O2S — CID 39166500
N-(2,5-dibromophenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 39166500) has the molecular formula C16H12Br2N2O2S and a molecular weight of 456.16 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-(2,5-dibromophenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 39166500 |
| Molecular Formula | C16H12Br2N2O2S |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.90 |
| IUPAC Name | N-(2,5-dibromophenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H12Br2N2O2S/c17-10-5-6-11(18)12(7-10)19-15(21)8-20-13-3-1-2-4-14(13)23-9-16(20)22/h1-7H,8-9H2,(H,19,21) |
| InChIKey | VSOJFZOREGTFSI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |