C17H15BrN2O2S — CID 30692312
N-(2-bromo-4-methylphenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 30692312) has the molecular formula C17H15BrN2O2S and a molecular weight of 391.29 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 30692312 |
| Molecular Formula | C17H15BrN2O2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)CSc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C17H15BrN2O2S/c1-11-6-7-13(12(18)8-11)19-16(21)9-20-14-4-2-3-5-15(14)23-10-17(20)22/h2-8H,9-10H2,1H3,(H,19,21) |
| InChIKey | AZHCXWWLZLWDIZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |