C17H14BrClN2O2S — CID 16563148
N-(4-bromo-2-chlorophenyl)-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide (PubChem CID 16563148) has the molecular formula C17H14BrClN2O2S and a molecular weight of 425.74 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
|---|---|
| PubChem CID | 16563148 |
| Molecular Formula | C17H14BrClN2O2S |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-3-(3-oxo-1,4-benzothiazin-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)CSc2ccccc21)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H14BrClN2O2S/c18-11-5-6-13(12(19)9-11)20-16(22)7-8-21-14-3-1-2-4-15(14)24-10-17(21)23/h1-6,9H,7-8,10H2,(H,20,22) |
| InChIKey | WXNLBBZGMOGALO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |