C13H12N2O2S — CID 18110081
2-(3-oxo-1,4-benzothiazin-4-yl)-N-prop-2-ynylacetamide (PubChem CID 18110081) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 18110081 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C13H12N2O2S/c1-2-7-14-12(16)8-15-10-5-3-4-6-11(10)18-9-13(15)17/h1,3-6H,7-9H2,(H,14,16) |
| InChIKey | WPKNDOHNWCLRAZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|