About 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide (PubChem CID 18120233) has the molecular formula C20H22N2O3S
and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide |
| PubChem CID | 18120233 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)NCCCCOc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c23-19(21-12-6-7-13-25-16-8-2-1-3-9-16)14-22-17-10-4-5-11-18(17)26-15-20(22)24/h1-5,8-11H,6-7,12-15H2,(H,21,23) |
| InChIKey | ZPFDYDMYYJEWPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide?
The IUPAC name of 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide (CID 18120233) is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide.
What is the SMILES notation for 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide?
The canonical SMILES for 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide is O=C(CN1C(=O)CSc2ccccc21)NCCCCOc1ccccc1.
What is the InChIKey of 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide?
The InChIKey is ZPFDYDMYYJEWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3S/c23-19(21-12-6-7-13-25-16-8-2-1-3-9-16)14-22-17-10-4-5-11-18(17)26-15-20(22)24/h1-5,8-11H,6-7,12-15H2,(H,21,23).
What are the key properties of 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide?
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide has a molecular weight of 370.47 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(4-phenoxybutyl)acetamide is sourced from PubChem (CID 18120233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).