C16H18N4O2S — CID 37393707
2-(3-oxo-1,4-benzothiazin-4-yl)-N-(3-pyrazol-1-ylpropyl)acetamide (PubChem CID 37393707) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(3-pyrazol-1-ylpropyl)acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(3-pyrazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 37393707 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-(3-pyrazol-1-ylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)NCCCn1cccn1 |
| InChI | InChI=1S/C16H18N4O2S/c21-15(17-7-3-9-19-10-4-8-18-19)11-20-13-5-1-2-6-14(13)23-12-16(20)22/h1-2,4-6,8,10H,3,7,9,11-12H2,(H,17,21) |
| InChIKey | XOPGODJBZFVWAF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|