C19H14F6N2O3 — CID 26840117
(E)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enehydrazide (PubChem CID 26840117) has the molecular formula C19H14F6N2O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is (E)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 26840117 |
| Molecular Formula | C19H14F6N2O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (E)-N'-[2-[3-(trifluoromethyl)phenoxy]acetyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)NNC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F6N2O3/c20-18(21,22)13-4-1-3-12(9-13)7-8-16(28)26-27-17(29)11-30-15-6-2-5-14(10-15)19(23,24)25/h1-10H,11H2,(H,26,28)(H,27,29)/b8-7+ |
| InChIKey | MNDRYRLPMVBLIV-BQYQJAHWSA-N |
| XLogP | 3.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|