C19H16N4O4S — CID 18159222
N'-[2-(4-cyanophenoxy)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide (PubChem CID 18159222) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
|---|---|
| PubChem CID | 18159222 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)c2ccc3c(c2)NC(=O)CCS3)cc1 |
| InChI | InChI=1S/C19H16N4O4S/c20-10-12-1-4-14(5-2-12)27-11-18(25)22-23-19(26)13-3-6-16-15(9-13)21-17(24)7-8-28-16/h1-6,9H,7-8,11H2,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | HSHSRKFRSDWOFS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|