C18H16ClN3O3S — CID 30755493
N'-[2-(4-chlorophenyl)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide (PubChem CID 30755493) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
|---|---|
| PubChem CID | 30755493 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carbohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C18H16ClN3O3S/c19-13-4-1-11(2-5-13)9-17(24)21-22-18(25)12-3-6-15-14(10-12)20-16(23)7-8-26-15/h1-6,10H,7-9H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | HOLYHVLEECHUCY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|