C15H20N2O2S — CID 32684583
4-oxo-N-pentyl-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide (PubChem CID 32684583) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-oxo-N-pentyl-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide.
| Compound Name | 4-oxo-N-pentyl-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 32684583 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-oxo-N-pentyl-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C15H20N2O2S/c1-2-3-4-8-16-15(19)11-5-6-13-12(10-11)17-14(18)7-9-20-13/h5-6,10H,2-4,7-9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | SBFHCWMUZKCNAS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|