C16H20N2O4S — CID 7848279
[2-(butylamino)-2-oxoethyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate (PubChem CID 7848279) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
|---|---|
| PubChem CID | 7848279 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C16H20N2O4S/c1-2-3-7-17-15(20)10-22-16(21)11-4-5-13-12(9-11)18-14(19)6-8-23-13/h4-5,9H,2-3,6-8,10H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | QURGADYRVHWRPF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|