C18H15F2N3O5 — CID 7978485
N'-[2-(4-cyanophenoxy)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide (PubChem CID 7978485) has the molecular formula C18H15F2N3O5 and a molecular weight of 391.33 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 7978485 |
| Molecular Formula | C18H15F2N3O5 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-4-(difluoromethoxy)-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccc(C#N)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H15F2N3O5/c1-26-15-8-12(4-7-14(15)28-18(19)20)17(25)23-22-16(24)10-27-13-5-2-11(9-21)3-6-13/h2-8,18H,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | FYJVSZCYIRAGBF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|