C24H20ClN3O5 — CID 24635798
4-[(2-chlorophenyl)methoxy]-N'-[2-(4-cyanophenoxy)acetyl]-3-methoxybenzohydrazide (PubChem CID 24635798) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-N'-[2-(4-cyanophenoxy)acetyl]-3-methoxybenzohydrazide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-N'-[2-(4-cyanophenoxy)acetyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 24635798 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-N'-[2-(4-cyanophenoxy)acetyl]-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)COc2ccc(C#N)cc2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H20ClN3O5/c1-31-22-12-17(8-11-21(22)33-14-18-4-2-3-5-20(18)25)24(30)28-27-23(29)15-32-19-9-6-16(13-26)7-10-19/h2-12H,14-15H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | JGJUVWZUCWQXTA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|