C20H19ClN4O4 — CID 55619649
4-[(2-chlorophenyl)methoxy]-3-methoxy-N'-(4-methoxypyrimidin-2-yl)benzohydrazide (PubChem CID 55619649) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-3-methoxy-N'-(4-methoxypyrimidin-2-yl)benzohydrazide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-3-methoxy-N'-(4-methoxypyrimidin-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 55619649 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-3-methoxy-N'-(4-methoxypyrimidin-2-yl)benzohydrazide |
| SMILES | COc1ccnc(NNC(=O)c2ccc(OCc3ccccc3Cl)c(OC)c2)n1 |
| InChI | InChI=1S/C20H19ClN4O4/c1-27-17-11-13(19(26)24-25-20-22-10-9-18(23-20)28-2)7-8-16(17)29-12-14-5-3-4-6-15(14)21/h3-11H,12H2,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | RCWQFGKQRDMSEJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|