phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate

C23H19ClO5 — CID 2454304

IUPACphenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate
SMILESCOc1cc(C(=O)OCC(=O)c2ccccc2)ccc1OCc1ccccc1Cl
InChIInChI=1S/C23H19ClO5/c1-27-22-13-17(23(26)29-15-20(25)16-7-3-2-4-8-16)11-12-21(22)28-14-18-9-5-6-10-19(18)24/h2-13H,14-15H2,1H3
InChIKeyKFQHLDQEAKJWEO-UHFFFAOYSA-N
MW410.85 g/mol
LogP4.97
Rot. Bonds8

About phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate

phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate (PubChem CID 2454304) has the molecular formula C23H19ClO5 and a molecular weight of 410.85 g/mol. Its IUPAC name is phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate.

Molecular Properties

Compound Namephenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate
PubChem CID2454304
Molecular FormulaC23H19ClO5
Molecular Weight410.85 g/mol
Exact Mass410.09
IUPAC Namephenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate
SMILESCOc1cc(C(=O)OCC(=O)c2ccccc2)ccc1OCc1ccccc1Cl
InChIInChI=1S/C23H19ClO5/c1-27-22-13-17(23(26)29-15-20(25)16-7-3-2-4-8-16)11-12-21(22)28-14-18-9-5-6-10-19(18)24/h2-13H,14-15H2,1H3
InChIKeyKFQHLDQEAKJWEO-UHFFFAOYSA-N
XLogP4.97
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500410.85
LogP ≤ 54.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate?
The IUPAC name of phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate (CID 2454304) is phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate.
What is the SMILES notation for phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate?
The canonical SMILES for phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate is COc1cc(C(=O)OCC(=O)c2ccccc2)ccc1OCc1ccccc1Cl.
What is the InChIKey of phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate?
The InChIKey is KFQHLDQEAKJWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClO5/c1-27-22-13-17(23(26)29-15-20(25)16-7-3-2-4-8-16)11-12-21(22)28-14-18-9-5-6-10-19(18)24/h2-13H,14-15H2,1H3.
What are the key properties of phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate?
phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate has a molecular weight of 410.85 g/mol, XLogP of 4.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate is sourced from PubChem (CID 2454304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).