C24H22ClNO5 — CID 42964823
[2-(2-methylanilino)-2-oxoethyl] 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate (PubChem CID 42964823) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 42964823 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccccc2C)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H22ClNO5/c1-16-7-3-6-10-20(16)26-23(27)15-31-24(28)17-11-12-21(22(13-17)29-2)30-14-18-8-4-5-9-19(18)25/h3-13H,14-15H2,1-2H3,(H,26,27) |
| InChIKey | NQUVLCLZQCLDQC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |