C25H25NO5 — CID 42964833
[2-(2,3-dimethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 42964833) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 42964833 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2cccc(C)c2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H25NO5/c1-17-8-7-11-21(18(17)2)26-24(27)16-31-25(28)20-12-13-22(23(14-20)29-3)30-15-19-9-5-4-6-10-19/h4-14H,15-16H2,1-3H3,(H,26,27) |
| InChIKey | XPXXDUMPOIQGTD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |