C27H29NO5 — CID 42964839
[2-(2,6-diethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate (PubChem CID 42964839) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 42964839 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 3-methoxy-4-phenylmethoxybenzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H29NO5/c1-4-20-12-9-13-21(5-2)26(20)28-25(29)18-33-27(30)22-14-15-23(24(16-22)31-3)32-17-19-10-7-6-8-11-19/h6-16H,4-5,17-18H2,1-3H3,(H,28,29) |
| InChIKey | UTQQMVVLDHWJNN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |