C24H30N2O6 — CID 42373991
[2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 42373991) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 42373991 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)COC(=O)c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C24H30N2O6/c1-5-13-26(15-22(27)25-19-10-8-7-9-17(19)3)23(28)16-32-24(29)18-11-12-20(31-6-2)21(14-18)30-4/h7-12,14H,5-6,13,15-16H2,1-4H3,(H,25,27) |
| InChIKey | CNGKBDZZYAFKEC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |