C24H24ClN3O4 — CID 55999729
[2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55999729) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999729 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [2-[[2-(2-methylanilino)-2-oxoethyl]-propylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)COC(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C24H24ClN3O4/c1-3-12-28(14-22(29)27-19-7-5-4-6-16(19)2)23(30)15-32-24(31)18-8-10-20-17(13-18)9-11-21(25)26-20/h4-11,13H,3,12,14-15H2,1-2H3,(H,27,29) |
| InChIKey | CMIVRCQQGKATGI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|