C24H17ClN2O3 — CID 55730349
[2-oxo-2-(2-phenylanilino)ethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55730349) has the molecular formula C24H17ClN2O3 and a molecular weight of 416.86 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730349 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(Cl)ccc2c1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H17ClN2O3/c25-22-13-11-17-14-18(10-12-20(17)26-22)24(29)30-15-23(28)27-21-9-5-4-8-19(21)16-6-2-1-3-7-16/h1-14H,15H2,(H,27,28) |
| InChIKey | LEKHJHIQRXWMFC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|