About [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate
[2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate (PubChem CID 16521982) has the molecular formula C27H21NO4
and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate |
| PubChem CID | 16521982 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(Oc2ccccc2)c1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H21NO4/c29-26(28-25-17-8-7-16-24(25)20-10-3-1-4-11-20)19-31-27(30)21-12-9-15-23(18-21)32-22-13-5-2-6-14-22/h1-18H,19H2,(H,28,29) |
| InChIKey | ATALZVDDDVDTME-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate?
The IUPAC name of [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate (CID 16521982) is [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate.
What is the SMILES notation for [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate?
The canonical SMILES for [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate is O=C(COC(=O)c1cccc(Oc2ccccc2)c1)Nc1ccccc1-c1ccccc1.
What is the InChIKey of [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate?
The InChIKey is ATALZVDDDVDTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21NO4/c29-26(28-25-17-8-7-16-24(25)20-10-3-1-4-11-20)19-31-27(30)21-12-9-15-23(18-21)32-22-13-5-2-6-14-22/h1-18H,19H2,(H,28,29).
What are the key properties of [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate?
[2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate has a molecular weight of 423.47 g/mol, XLogP of 5.94, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-phenylanilino)ethyl] 3-phenoxybenzoate is sourced from PubChem (CID 16521982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).