C22H20ClN3O4 — CID 55730099
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55730099) has the molecular formula C22H20ClN3O4 and a molecular weight of 425.87 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55730099 |
| Molecular Formula | C22H20ClN3O4 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(Cl)ccc2c1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H20ClN3O4/c23-20-8-2-15-13-16(1-7-19(15)25-20)22(28)30-14-21(27)24-17-3-5-18(6-4-17)26-9-11-29-12-10-26/h1-8,13H,9-12,14H2,(H,24,27) |
| InChIKey | QJWSYGAPRGTXMM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|