C19H13ClF2N2O3S — CID 55998781
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55998781) has the molecular formula C19H13ClF2N2O3S and a molecular weight of 422.84 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998781 |
| Molecular Formula | C19H13ClF2N2O3S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(Cl)ccc2c1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H13ClF2N2O3S/c20-16-8-2-11-9-12(1-7-15(11)24-16)18(26)27-10-17(25)23-13-3-5-14(6-4-13)28-19(21)22/h1-9,19H,10H2,(H,23,25) |
| InChIKey | YZCRVNUOLUDCKL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|