C14H11F2NO4S — CID 2354784
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 2354784) has the molecular formula C14H11F2NO4S and a molecular weight of 327.31 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2354784 |
| Molecular Formula | C14H11F2NO4S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H11F2NO4S/c15-14(16)22-10-5-3-9(4-6-10)17-12(18)8-21-13(19)11-2-1-7-20-11/h1-7,14H,8H2,(H,17,18) |
| InChIKey | AINLRGXBAYAUCP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |