C15H13F2NO3S2 — CID 7837711
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 7837711) has the molecular formula C15H13F2NO3S2 and a molecular weight of 357.40 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7837711 |
| Molecular Formula | C15H13F2NO3S2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H13F2NO3S2/c1-9-6-7-22-13(9)14(20)21-8-12(19)18-10-2-4-11(5-3-10)23-15(16)17/h2-7,15H,8H2,1H3,(H,18,19) |
| InChIKey | WZGYAHPZQLAHLZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |