C14H8F5NO3S — CID 2351108
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 3-methylthiophene-2-carboxylate (PubChem CID 2351108) has the molecular formula C14H8F5NO3S and a molecular weight of 365.28 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2351108 |
| Molecular Formula | C14H8F5NO3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H8F5NO3S/c1-5-2-3-24-13(5)14(22)23-4-6(21)20-12-10(18)8(16)7(15)9(17)11(12)19/h2-3H,4H2,1H3,(H,20,21) |
| InChIKey | VIMSBLGDIUGGGH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|