C14H12F2N2O3S — CID 8543856
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8543856) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8543856 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C14H12F2N2O3S/c15-14(16)22-10-5-3-9(4-6-10)18-12(19)8-21-13(20)11-2-1-7-17-11/h1-7,14,17H,8H2,(H,18,19) |
| InChIKey | YFOHKCRGWDQUOP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |