C17H13ClF3NO3S — CID 7718334
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718334) has the molecular formula C17H13ClF3NO3S and a molecular weight of 403.81 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718334 |
| Molecular Formula | C17H13ClF3NO3S |
| Molecular Weight | 403.81 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1c(F)cccc1Cl)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF3NO3S/c18-13-2-1-3-14(19)12(13)8-16(24)25-9-15(23)22-10-4-6-11(7-5-10)26-17(20)21/h1-7,17H,8-9H2,(H,22,23) |
| InChIKey | YFLSTIMACBRFAJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |