C21H20F2N2O2S — CID 55354166
2-[benzyl(furan-2-ylmethyl)amino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 55354166) has the molecular formula C21H20F2N2O2S and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[benzyl(furan-2-ylmethyl)amino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55354166 |
| Molecular Formula | C21H20F2N2O2S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)Cc1ccco1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H20F2N2O2S/c22-21(23)28-19-10-8-17(9-11-19)24-20(26)15-25(14-18-7-4-12-27-18)13-16-5-2-1-3-6-16/h1-12,21H,13-15H2,(H,24,26) |
| InChIKey | PUYVJCDZPUGZNK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |