C20H16F2N2O4S — CID 2099371
[2-(furan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate (PubChem CID 2099371) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is [2-(furan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate.
| Compound Name | [2-(furan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
|---|---|
| PubChem CID | 2099371 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(furan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1Nc1ccc(SC(F)F)cc1)Nc1ccco1 |
| InChI | InChI=1S/C20H16F2N2O4S/c21-20(22)29-14-9-7-13(8-10-14)23-16-5-2-1-4-15(16)19(26)28-12-17(25)24-18-6-3-11-27-18/h1-11,20,23H,12H2,(H,24,25) |
| InChIKey | KADYFPMGBRFVAE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |