C15H11ClF2N2O3S — CID 55504987
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(difluoromethylsulfanyl)benzoate (PubChem CID 55504987) has the molecular formula C15H11ClF2N2O3S and a molecular weight of 372.78 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(difluoromethylsulfanyl)benzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(difluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55504987 |
| Molecular Formula | C15H11ClF2N2O3S |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(difluoromethylsulfanyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(SC(F)F)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H11ClF2N2O3S/c16-10-3-6-12(19-7-10)20-13(21)8-23-14(22)9-1-4-11(5-2-9)24-15(17)18/h1-7,15H,8H2,(H,19,20,21) |
| InChIKey | XNVDEQXQUUHPAR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |