C21H17ClN2O4 — CID 7284277
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 7284277) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 7284277 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C21H17ClN2O4/c22-17-8-11-19(23-12-17)24-20(25)14-28-21(26)16-6-9-18(10-7-16)27-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,23,24,25) |
| InChIKey | FIYKEGLTGJKDRR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |