C22H17ClFNO4 — CID 18209174
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 18209174) has the molecular formula C22H17ClFNO4 and a molecular weight of 413.83 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 18209174 |
| Molecular Formula | C22H17ClFNO4 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H17ClFNO4/c23-19-12-17(24)8-11-20(19)25-21(26)14-29-22(27)16-6-9-18(10-7-16)28-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,25,26) |
| InChIKey | VYTVLUFMHRYWTD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |