About (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate
(2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate (PubChem CID 7264153) has the molecular formula C23H19NO5
and a molecular weight of 389.41 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate |
| PubChem CID | 7264153 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19NO5/c25-21(24-22(26)18-9-5-2-6-10-18)16-29-23(27)19-11-13-20(14-12-19)28-15-17-7-3-1-4-8-17/h1-14H,15-16H2,(H,24,25,26) |
| InChIKey | YDJOITAOINUJOZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate?
The IUPAC name of (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate (CID 7264153) is (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate?
The canonical SMILES for (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate is O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate?
The InChIKey is YDJOITAOINUJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO5/c25-21(24-22(26)18-9-5-2-6-10-18)16-29-23(27)19-11-13-20(14-12-19)28-15-17-7-3-1-4-8-17/h1-14H,15-16H2,(H,24,25,26).
What are the key properties of (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate?
(2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate has a molecular weight of 389.41 g/mol, XLogP of 3.38, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) 4-phenylmethoxybenzoate is sourced from PubChem (CID 7264153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).