C23H20N2O5 — CID 17178415
methyl 4-[[(4-phenylmethoxybenzoyl)amino]carbamoyl]benzoate (PubChem CID 17178415) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 4-[[(4-phenylmethoxybenzoyl)amino]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(4-phenylmethoxybenzoyl)amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17178415 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 4-[[(4-phenylmethoxybenzoyl)amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NNC(=O)c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c1-29-23(28)19-9-7-17(8-10-19)21(26)24-25-22(27)18-11-13-20(14-12-18)30-15-16-5-3-2-4-6-16/h2-14H,15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | HKWMDGHQWPRXRH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|